C29H28N4O3 — CID 90519570
1-[6-(4-methoxyphenyl)pyrimidin-4-yl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide (PubChem CID 90519570) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-[6-(4-methoxyphenyl)pyrimidin-4-yl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[6-(4-methoxyphenyl)pyrimidin-4-yl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90519570 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 1-[6-(4-methoxyphenyl)pyrimidin-4-yl]-N-(4-phenoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(-c2cc(N3CCC(C(=O)Nc4ccc(Oc5ccccc5)cc4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C29H28N4O3/c1-35-24-11-7-21(8-12-24)27-19-28(31-20-30-27)33-17-15-22(16-18-33)29(34)32-23-9-13-26(14-10-23)36-25-5-3-2-4-6-25/h2-14,19-20,22H,15-18H2,1H3,(H,32,34) |
| InChIKey | PXOSTVAGQCNNMB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |