C18H28O6 — CID 10914773
[(E,1S)-1-[(3aS,4S,6S,7aS)-6-methoxy-2-oxo-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-4-yl]oct-2-enyl] acetate (PubChem CID 10914773) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(E,1S)-1-[(3aS,4S,6S,7aS)-6-methoxy-2-oxo-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-4-yl]oct-2-enyl] acetate.
| Compound Name | [(E,1S)-1-[(3aS,4S,6S,7aS)-6-methoxy-2-oxo-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-4-yl]oct-2-enyl] acetate |
|---|---|
| PubChem CID | 10914773 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(E,1S)-1-[(3aS,4S,6S,7aS)-6-methoxy-2-oxo-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-4-yl]oct-2-enyl] acetate |
| SMILES | CCCCC/C=C/[C@H](OC(C)=O)[C@H]1O[C@H](OC)C[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C18H28O6/c1-4-5-6-7-8-9-14(22-12(2)19)18-13-10-16(20)23-15(13)11-17(21-3)24-18/h8-9,13-15,17-18H,4-7,10-11H2,1-3H3/b9-8+/t13-,14-,15-,17-,18-/m0/s1 |
| InChIKey | HCFWYXXFOGNGSM-PWQPQYFASA-N |
| XLogP | 2.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|