C17H28O5 — CID 139583457
(2S,3R,4S,4aR,7S,7aS)-2-[(Z)-3,5-dimethylhept-1-enyl]-3,4-dihydroxy-7-methyl-2,3,4,4a,7,7a-hexahydrofuro[3,4-b]pyran-5-one (PubChem CID 139583457) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,3R,4S,4aR,7S,7aS)-2-[(Z)-3,5-dimethylhept-1-enyl]-3,4-dihydroxy-7-methyl-2,3,4,4a,7,7a-hexahydrofuro[3,4-b]pyran-5-one.
| Compound Name | (2S,3R,4S,4aR,7S,7aS)-2-[(Z)-3,5-dimethylhept-1-enyl]-3,4-dihydroxy-7-methyl-2,3,4,4a,7,7a-hexahydrofuro[3,4-b]pyran-5-one |
|---|---|
| PubChem CID | 139583457 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2S,3R,4S,4aR,7S,7aS)-2-[(Z)-3,5-dimethylhept-1-enyl]-3,4-dihydroxy-7-methyl-2,3,4,4a,7,7a-hexahydrofuro[3,4-b]pyran-5-one |
| SMILES | CCC(C)CC(C)/C=C\[C@@H]1O[C@H]2[C@H](C(=O)O[C@H]2C)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H28O5/c1-5-9(2)8-10(3)6-7-12-14(18)15(19)13-16(22-12)11(4)21-17(13)20/h6-7,9-16,18-19H,5,8H2,1-4H3/b7-6-/t9?,10?,11-,12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | AUUCDSHFBVTBJU-QOBQZLOASA-N |
| XLogP | 1.67 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|