C20H31N3O2 — CID 109148789
4-N,4-N-dipropyl-1-N-(pyridin-3-ylmethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109148789) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-N,4-N-dipropyl-1-N-(pyridin-3-ylmethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N,4-N-dipropyl-1-N-(pyridin-3-ylmethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109148789 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 4-N,4-N-dipropyl-1-N-(pyridin-3-ylmethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCC(C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-3-12-23(13-4-2)20(25)18-9-7-17(8-10-18)19(24)22-15-16-6-5-11-21-14-16/h5-6,11,14,17-18H,3-4,7-10,12-13,15H2,1-2H3,(H,22,24) |
| InChIKey | FQJBUDIIMMLUIA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |