C24H37N3O2 — CID 109149372
N-(3-methylbutyl)-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide (PubChem CID 109149372) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-(3-methylbutyl)-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | N-(3-methylbutyl)-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109149372 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | N-(3-methylbutyl)-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C3CCC(C(=O)NCCC(C)C)CC3)CC2)c1 |
| InChI | InChI=1S/C24H37N3O2/c1-18(2)11-12-25-23(28)20-7-9-21(10-8-20)24(29)27-15-13-26(14-16-27)22-6-4-5-19(3)17-22/h4-6,17-18,20-21H,7-16H2,1-3H3,(H,25,28) |
| InChIKey | HSKOQOGLSOPTAO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |