C24H37N3O2 — CID 109149374
N-butyl-N-methyl-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide (PubChem CID 109149374) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is N-butyl-N-methyl-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | N-butyl-N-methyl-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109149374 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | N-butyl-N-methyl-4-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclohexane-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCC(C(=O)N2CCN(c3cccc(C)c3)CC2)CC1 |
| InChI | InChI=1S/C24H37N3O2/c1-4-5-13-25(3)23(28)20-9-11-21(12-10-20)24(29)27-16-14-26(15-17-27)22-8-6-7-19(2)18-22/h6-8,18,20-21H,4-5,9-17H2,1-3H3 |
| InChIKey | WGVZOIOMDKKKND-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |