C22H31N5O — CID 109154403
6-(4-benzylpiperazin-1-yl)-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide (PubChem CID 109154403) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109154403 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-N-[3-(dimethylamino)propyl]pyridine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(N2CCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C22H31N5O/c1-25(2)12-6-11-23-22(28)20-9-10-21(24-17-20)27-15-13-26(14-16-27)18-19-7-4-3-5-8-19/h3-5,7-10,17H,6,11-16,18H2,1-2H3,(H,23,28) |
| InChIKey | ZUOXPVFGBYPBBY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|