C18H30N4O3S — CID 38106007
N-[3-(dimethylamino)propyl]-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 38106007) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 38106007 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1ccc(CN2CCN(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C18H30N4O3S/c1-20(2)10-4-9-19-18(23)17-7-5-16(6-8-17)15-21-11-13-22(14-12-21)26(3,24)25/h5-8H,4,9-15H2,1-3H3,(H,19,23) |
| InChIKey | PYPPZLCXVSCNIV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|