C23H25N3O2 — CID 109155845
6-[(3-methylphenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide (PubChem CID 109155845) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 6-[(3-methylphenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-[(3-methylphenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109155845 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 6-[(3-methylphenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyridine-3-carboxamide |
| SMILES | Cc1cccc(CNc2ccc(C(=O)Nc3ccccc3OC(C)C)cn2)c1 |
| InChI | InChI=1S/C23H25N3O2/c1-16(2)28-21-10-5-4-9-20(21)26-23(27)19-11-12-22(25-15-19)24-14-18-8-6-7-17(3)13-18/h4-13,15-16H,14H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | WHZFKVGMCZZHFP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |