C21H21FN4O2 — CID 109257339
2-[(4-fluorophenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyrimidine-5-carboxamide (PubChem CID 109257339) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109257339 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[(4-fluorophenyl)methylamino]-N-(2-propan-2-yloxyphenyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)c1cnc(NCc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C21H21FN4O2/c1-14(2)28-19-6-4-3-5-18(19)26-20(27)16-12-24-21(25-13-16)23-11-15-7-9-17(22)10-8-15/h3-10,12-14H,11H2,1-2H3,(H,26,27)(H,23,24,25) |
| InChIKey | UDOYDAUXBKZOOI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |