C21H20ClN3O2 — CID 109156064
6-(5-chloro-2-methoxyanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide (PubChem CID 109156064) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-(5-chloro-2-methoxyanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109156064 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 6-(5-chloro-2-methoxyanilino)-N-[(4-methylphenyl)methyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1Nc1ccc(C(=O)NCc2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-14-3-5-15(6-4-14)12-24-21(26)16-7-10-20(23-13-16)25-18-11-17(22)8-9-19(18)27-2/h3-11,13H,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NGURJMGTPXABLU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |