C22H16N2S2 — CID 10915694
(2Z)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-1-phenylethanethione (PubChem CID 10915694) has the molecular formula C22H16N2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is (2Z)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-1-phenylethanethione.
| Compound Name | (2Z)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-1-phenylethanethione |
|---|---|
| PubChem CID | 10915694 |
| Molecular Formula | C22H16N2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2Z)-2-(3,5-diphenyl-1,3,4-thiadiazol-2-ylidene)-1-phenylethanethione |
| SMILES | S=C(/C=C1\SC(c2ccccc2)=NN1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16N2S2/c25-20(17-10-4-1-5-11-17)16-21-24(19-14-8-3-9-15-19)23-22(26-21)18-12-6-2-7-13-18/h1-16H/b21-16- |
| InChIKey | IMNLDSIWJRZMBH-PGMHBOJBSA-N |
| XLogP | 5.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|