C23H29FN4O — CID 109160477
[6-(cycloheptylamino)-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 109160477) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is [6-(cycloheptylamino)-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [6-(cycloheptylamino)-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109160477 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [6-(cycloheptylamino)-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(NC2CCCCCC2)nc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H29FN4O/c24-20-9-5-6-10-21(20)27-13-15-28(16-14-27)23(29)18-11-12-22(25-17-18)26-19-7-3-1-2-4-8-19/h5-6,9-12,17,19H,1-4,7-8,13-16H2,(H,25,26) |
| InChIKey | LCMQGTFWONQVGT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |