C20H24FN5O — CID 109249582
N-cyclopentyl-2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-5-carboxamide (PubChem CID 109249582) has the molecular formula C20H24FN5O and a molecular weight of 369.44 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | N-cyclopentyl-2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109249582 |
| Molecular Formula | C20H24FN5O |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-cyclopentyl-2-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cnc(N2CCN(c3ccccc3F)CC2)nc1 |
| InChI | InChI=1S/C20H24FN5O/c21-17-7-3-4-8-18(17)25-9-11-26(12-10-25)20-22-13-15(14-23-20)19(27)24-16-5-1-2-6-16/h3-4,7-8,13-14,16H,1-2,5-6,9-12H2,(H,24,27) |
| InChIKey | DFELRKPAFQKFMI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |