C21H26FN5O — CID 109342025
N-cyclohexyl-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide (PubChem CID 109342025) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is N-cyclohexyl-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide.
| Compound Name | N-cyclohexyl-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109342025 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-cyclohexyl-6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(N2CCN(c3ccccc3F)CC2)ncn1 |
| InChI | InChI=1S/C21H26FN5O/c22-17-8-4-5-9-19(17)26-10-12-27(13-11-26)20-14-18(23-15-24-20)21(28)25-16-6-2-1-3-7-16/h4-5,8-9,14-16H,1-3,6-7,10-13H2,(H,25,28) |
| InChIKey | VZKBFURMGKMBDB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |