C18H29BrO4 — CID 10916104
(2R,4aS,6R,8aR)-2-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-carbaldehyde (PubChem CID 10916104) has the molecular formula C18H29BrO4 and a molecular weight of 389.33 g/mol. Its IUPAC name is (2R,4aS,6R,8aR)-2-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-carbaldehyde.
| Compound Name | (2R,4aS,6R,8aR)-2-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-carbaldehyde |
|---|---|
| PubChem CID | 10916104 |
| Molecular Formula | C18H29BrO4 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (2R,4aS,6R,8aR)-2-[(2S,5R)-5-bromo-2,6,6-trimethyloxan-2-yl]-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-carbaldehyde |
| SMILES | CC1(C)O[C@](C)([C@H]2CC[C@]3(C)O[C@@H](C=O)CC[C@H]3O2)CC[C@H]1Br |
| InChI | InChI=1S/C18H29BrO4/c1-16(2)13(19)7-9-18(4,23-16)15-8-10-17(3)14(21-15)6-5-12(11-20)22-17/h11-15H,5-10H2,1-4H3/t12-,13-,14-,15-,17+,18+/m1/s1 |
| InChIKey | TUIMUTBMMHDJNA-CNGUFQHNSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|