C17H27BrO4 — CID 163109269
6-(5-bromo-2,6,6-trimethyloxan-2-yl)-8a-methyl-3,4,4a,6,7,8-hexahydropyrano[3,2-b]pyran-2-one (PubChem CID 163109269) has the molecular formula C17H27BrO4 and a molecular weight of 375.30 g/mol. Its IUPAC name is 6-(5-bromo-2,6,6-trimethyloxan-2-yl)-8a-methyl-3,4,4a,6,7,8-hexahydropyrano[3,2-b]pyran-2-one.
| Compound Name | 6-(5-bromo-2,6,6-trimethyloxan-2-yl)-8a-methyl-3,4,4a,6,7,8-hexahydropyrano[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 163109269 |
| Molecular Formula | C17H27BrO4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-(5-bromo-2,6,6-trimethyloxan-2-yl)-8a-methyl-3,4,4a,6,7,8-hexahydropyrano[3,2-b]pyran-2-one |
| SMILES | CC1(C)OC(C)(C2CCC3(C)OC(=O)CCC3O2)CCC1Br |
| InChI | InChI=1S/C17H27BrO4/c1-15(2)11(18)7-9-17(4,22-15)13-8-10-16(3)12(20-13)5-6-14(19)21-16/h11-13H,5-10H2,1-4H3 |
| InChIKey | HECWWSBEMBBKGK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|