C19H23N3O3 — CID 109161262
methyl 4-[[5-(3-methylbutylcarbamoyl)-2-pyridinyl]amino]benzoate (PubChem CID 109161262) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 4-[[5-(3-methylbutylcarbamoyl)-2-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[5-(3-methylbutylcarbamoyl)-2-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109161262 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl 4-[[5-(3-methylbutylcarbamoyl)-2-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc(C(=O)NCCC(C)C)cn2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-13(2)10-11-20-18(23)15-6-9-17(21-12-15)22-16-7-4-14(5-8-16)19(24)25-3/h4-9,12-13H,10-11H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | SESOGGZIRLIJIK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |