C25H34N4 — CID 10916160
(3S,5S)-3,5-dimethyl-2,6,14,21-tetrazatricyclo[20.5.0.07,13]heptacosa-1(27),7,9,11,13,21,23,25-octaene (PubChem CID 10916160) has the molecular formula C25H34N4 and a molecular weight of 390.57 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-2,6,14,21-tetrazatricyclo[20.5.0.07,13]heptacosa-1(27),7,9,11,13,21,23,25-octaene.
| Compound Name | (3S,5S)-3,5-dimethyl-2,6,14,21-tetrazatricyclo[20.5.0.07,13]heptacosa-1(27),7,9,11,13,21,23,25-octaene |
|---|---|
| PubChem CID | 10916160 |
| Molecular Formula | C25H34N4 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-2,6,14,21-tetrazatricyclo[20.5.0.07,13]heptacosa-1(27),7,9,11,13,21,23,25-octaene |
| SMILES | C[C@H]1C[C@H](C)NC2=CC=CC=C/C2=N\CCCCCC/N=C2\C=CC=CC=C2N1 |
| InChI | InChI=1S/C25H34N4/c1-20-19-21(2)29-25-16-10-6-8-14-23(25)27-18-12-4-3-11-17-26-22-13-7-5-9-15-24(22)28-20/h5-10,13-16,20-21,28-29H,3-4,11-12,17-19H2,1-2H3/b26-22+,27-23+/t20-,21-/m0/s1 |
| InChIKey | LSEDVKYGFKNXQJ-KELNJLITSA-N |
| XLogP | 4.81 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|