C27H45N3 — CID 174024926
(3Z,4E)-5-[(Z)-but-1-enyl]-2-N-cycloheptyl-7-methyl-8-methylimino-3-pentan-2-ylidenenona-1,4,6-triene-2,6-diamine (PubChem CID 174024926) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is (3Z,4E)-5-[(Z)-but-1-enyl]-2-N-cycloheptyl-7-methyl-8-methylimino-3-pentan-2-ylidenenona-1,4,6-triene-2,6-diamine.
| Compound Name | (3Z,4E)-5-[(Z)-but-1-enyl]-2-N-cycloheptyl-7-methyl-8-methylimino-3-pentan-2-ylidenenona-1,4,6-triene-2,6-diamine |
|---|---|
| PubChem CID | 174024926 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | (3Z,4E)-5-[(Z)-but-1-enyl]-2-N-cycloheptyl-7-methyl-8-methylimino-3-pentan-2-ylidenenona-1,4,6-triene-2,6-diamine |
| SMILES | C=C(NC1CCCCCC1)C(/C=C(\C=C/CC)C(N)=C(C)/C(C)=N/C)=C(/C)CCC |
| InChI | InChI=1S/C27H45N3/c1-8-10-16-24(27(28)21(4)22(5)29-7)19-26(20(3)15-9-2)23(6)30-25-17-13-11-12-14-18-25/h10,16,19,25,30H,6,8-9,11-15,17-18,28H2,1-5,7H3/b16-10-,24-19+,26-20-,27-21?,29-22+ |
| InChIKey | SGXYFZWQUDHSHI-JXVJNJHVSA-N |
| XLogP | 7.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|