C31H47FN4 — CID 143342612
N-[(4E)-6-[[(6E)-6,7-dimethylnona-6,8-dien-2-yl]amino]-2-[[(3Z,5E)-5-fluoro-6-methylocta-3,5,7-trienyl]amino]-5-methylhepta-1,4,6-trien-3-ylidene]-N'-methylethanimidamide (PubChem CID 143342612) has the molecular formula C31H47FN4 and a molecular weight of 494.74 g/mol. Its IUPAC name is N-[(4E)-6-[[(6E)-6,7-dimethylnona-6,8-dien-2-yl]amino]-2-[[(3Z,5E)-5-fluoro-6-methylocta-3,5,7-trienyl]amino]-5-methylhepta-1,4,6-trien-3-ylidene]-N'-methylethanimidamide.
| Compound Name | N-[(4E)-6-[[(6E)-6,7-dimethylnona-6,8-dien-2-yl]amino]-2-[[(3Z,5E)-5-fluoro-6-methylocta-3,5,7-trienyl]amino]-5-methylhepta-1,4,6-trien-3-ylidene]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 143342612 |
| Molecular Formula | C31H47FN4 |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | N-[(4E)-6-[[(6E)-6,7-dimethylnona-6,8-dien-2-yl]amino]-2-[[(3Z,5E)-5-fluoro-6-methylocta-3,5,7-trienyl]amino]-5-methylhepta-1,4,6-trien-3-ylidene]-N'-methylethanimidamide |
| SMILES | C=C/C(C)=C(F)\C=C/CCNC(=C)C(/C=C(\C)C(=C)NC(C)CCC/C(C)=C(\C)C=C)=N/C(C)=N/C |
| InChI | InChI=1S/C31H47FN4/c1-12-22(3)24(5)17-16-18-26(7)35-27(8)25(6)21-31(36-29(10)33-11)28(9)34-20-15-14-19-30(32)23(4)13-2/h12-14,19,21,26,34-35H,1-2,8-9,15-18,20H2,3-7,10-11H3/b19-14-,24-22+,25-21+,30-23+,33-29+,36-31+ |
| InChIKey | JETLUMXSBRQDRY-LCXFAWQMSA-N |
| XLogP | 8.09 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|