C22H30FN3 — CID 143344774
N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide (PubChem CID 143344774) has the molecular formula C22H30FN3 and a molecular weight of 355.50 g/mol. Its IUPAC name is N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide.
| Compound Name | N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide |
|---|---|
| PubChem CID | 143344774 |
| Molecular Formula | C22H30FN3 |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide |
| SMILES | C=C(C)/C(C)=C/C(=N\C(C)=N\CC)C(=C)NCC1=CC(C)=C(F)C=CC1 |
| InChI | InChI=1S/C22H30FN3/c1-8-24-19(7)26-22(13-16(4)15(2)3)18(6)25-14-20-10-9-11-21(23)17(5)12-20/h9,11-13,25H,2,6,8,10,14H2,1,3-5,7H3/b16-13+,24-19+,26-22+ |
| InChIKey | DKHYSXLRCVZLFT-ORJJATDASA-N |
| XLogP | 5.62 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|