C19H24FN3 — CID 176561633
(2E,4E)-N-[[3-[(Z)-but-1-enyl]imino-4-iminocyclohexa-1,5-dien-1-yl]methyl]-5-fluoro-4-methylhepta-2,4,6-trien-3-amine (PubChem CID 176561633) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is (2E,4E)-N-[[3-[(Z)-but-1-enyl]imino-4-iminocyclohexa-1,5-dien-1-yl]methyl]-5-fluoro-4-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-N-[[3-[(Z)-but-1-enyl]imino-4-iminocyclohexa-1,5-dien-1-yl]methyl]-5-fluoro-4-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 176561633 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2E,4E)-N-[[3-[(Z)-but-1-enyl]imino-4-iminocyclohexa-1,5-dien-1-yl]methyl]-5-fluoro-4-methylhepta-2,4,6-trien-3-amine |
| SMILES | [H]/N=C1\C=CC(CNC(=C/C)/C(C)=C(/F)C=C)=C\C1=N/C=C\CC |
| InChI | InChI=1S/C19H24FN3/c1-5-8-11-22-19-12-15(9-10-17(19)21)13-23-18(7-3)14(4)16(20)6-2/h6-12,21,23H,2,5,13H2,1,3-4H3/b11-8-,16-14+,18-7+,21-17+,22-19+ |
| InChIKey | FCJDEAVNAVCHFL-PBOKHDOTSA-N |
| XLogP | 4.79 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|