C30H40FN5 — CID 143344314
2-N-[(3Z,5Z)-7-[[[(5E)-3-[(E)-1-(ethylideneamino)prop-1-en-2-yl]imino-6,7-dimethylocta-1,5,7-trien-2-yl]amino]methyl]-4-fluoroocta-3,5,7-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine (PubChem CID 143344314) has the molecular formula C30H40FN5 and a molecular weight of 489.68 g/mol. Its IUPAC name is 2-N-[(3Z,5Z)-7-[[[(5E)-3-[(E)-1-(ethylideneamino)prop-1-en-2-yl]imino-6,7-dimethylocta-1,5,7-trien-2-yl]amino]methyl]-4-fluoroocta-3,5,7-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine.
| Compound Name | 2-N-[(3Z,5Z)-7-[[[(5E)-3-[(E)-1-(ethylideneamino)prop-1-en-2-yl]imino-6,7-dimethylocta-1,5,7-trien-2-yl]amino]methyl]-4-fluoroocta-3,5,7-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine |
|---|---|
| PubChem CID | 143344314 |
| Molecular Formula | C30H40FN5 |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 2-N-[(3Z,5Z)-7-[[[(5E)-3-[(E)-1-(ethylideneamino)prop-1-en-2-yl]imino-6,7-dimethylocta-1,5,7-trien-2-yl]amino]methyl]-4-fluoroocta-3,5,7-trien-3-yl]-3,4-dimethylidenecyclobutene-1,2-diamine |
| SMILES | C=C(/C=C\C(F)=C(/CC)NC1=C(N)C(=C)C1=C)CNC(=C)/C(C/C=C(\C)C(=C)C)=N/C(C)=C/N=C/C |
| InChI | InChI=1S/C30H40FN5/c1-11-27(36-30-24(9)23(8)29(30)32)26(31)15-13-20(5)17-34-25(10)28(16-14-21(6)19(3)4)35-22(7)18-33-12-2/h12-15,18,34,36H,3,5,8-11,16-17,32H2,1-2,4,6-7H3/b15-13-,21-14+,22-18+,27-26-,33-12+,35-28+ |
| InChIKey | MJGHFRQMCUZUCN-SWYZGQCYSA-N |
| XLogP | 6.98 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|