C19H27FN2 — CID 137465240
(4E,6E)-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-4,7-dimethyl-8-methyliminonona-1,4,6-trien-2-amine (PubChem CID 137465240) has the molecular formula C19H27FN2 and a molecular weight of 302.44 g/mol. Its IUPAC name is (4E,6E)-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-4,7-dimethyl-8-methyliminonona-1,4,6-trien-2-amine.
| Compound Name | (4E,6E)-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-4,7-dimethyl-8-methyliminonona-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 137465240 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4E,6E)-N-[(2E)-2-ethenyl-4-fluoropenta-2,4-dienyl]-4,7-dimethyl-8-methyliminonona-1,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C(=C)F)CNC(=C)C/C(C)=C/C=C(C)/C(C)=N/C |
| InChI | InChI=1S/C19H27FN2/c1-8-19(12-16(4)20)13-22-17(5)11-14(2)9-10-15(3)18(6)21-7/h8-10,12,22H,1,4-5,11,13H2,2-3,6-7H3/b14-9+,15-10+,19-12+,21-18+ |
| InChIKey | VBYCOJSOFKRIDX-RWBBIDGYSA-N |
| XLogP | 5.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|