C17H23FN2 — CID 130336733
(3E)-3-fluoro-4-[[(5Z)-6-methyl-3-methylidene-4-propan-2-ylideneocta-5,7-dien-2-ylidene]amino]buta-1,3-dien-2-amine (PubChem CID 130336733) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is (3E)-3-fluoro-4-[[(5Z)-6-methyl-3-methylidene-4-propan-2-ylideneocta-5,7-dien-2-ylidene]amino]buta-1,3-dien-2-amine.
| Compound Name | (3E)-3-fluoro-4-[[(5Z)-6-methyl-3-methylidene-4-propan-2-ylideneocta-5,7-dien-2-ylidene]amino]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 130336733 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (3E)-3-fluoro-4-[[(5Z)-6-methyl-3-methylidene-4-propan-2-ylideneocta-5,7-dien-2-ylidene]amino]buta-1,3-dien-2-amine |
| SMILES | CC(=C(/C=C(/C)\C=C)C(=C)C(=N/C=C(\C(=C)N)/F)C)C |
| InChI | InChI=1S/C17H23FN2/c1-8-12(4)9-16(11(2)3)13(5)15(7)20-10-17(18)14(6)19/h8-10H,1,5-6,19H2,2-4,7H3/b12-9-,17-10+,20-15? |
| InChIKey | CVYQTGAUDKHBLB-KXQWDDAGSA-N |
| XLogP | 4.90 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 539 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|