C23H25FN2 — CID 123938860
5-ethenyl-9-fluoro-2-methyl-10-N-methylidene-3-penta-1,3,4-trienyl-4-prop-1-enylideneundeca-2,5,8,10-tetraene-1,10-diimine (PubChem CID 123938860) has the molecular formula C23H25FN2 and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-ethenyl-9-fluoro-2-methyl-10-N-methylidene-3-penta-1,3,4-trienyl-4-prop-1-enylideneundeca-2,5,8,10-tetraene-1,10-diimine.
| Compound Name | 5-ethenyl-9-fluoro-2-methyl-10-N-methylidene-3-penta-1,3,4-trienyl-4-prop-1-enylideneundeca-2,5,8,10-tetraene-1,10-diimine |
|---|---|
| PubChem CID | 123938860 |
| Molecular Formula | C23H25FN2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 5-ethenyl-9-fluoro-2-methyl-10-N-methylidene-3-penta-1,3,4-trienyl-4-prop-1-enylideneundeca-2,5,8,10-tetraene-1,10-diimine |
| SMILES | [H]/N=C/C(C)=C(C=CC=C=C)C(=C=CC)C(C=C)=CCC=C(F)C(=C)N=C |
| InChI | InChI=1S/C23H25FN2/c1-7-10-11-15-21(18(4)17-25)22(13-8-2)20(9-3)14-12-16-23(24)19(5)26-6/h8-11,14-17,25H,1,3,5-6,12H2,2,4H3/b15-11?,20-14?,21-18?,23-16?,25-17+ |
| InChIKey | QNIWYUJRUPVPJL-UGZICFSQSA-N |
| XLogP | 6.52 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|