C18H25FN2 — CID 135244533
(Z)-4-[(3E,4E,6Z)-3-ethylidene-6-methyl-4-prop-1-en-2-ylocta-1,4,6-trien-2-yl]imino-3-fluorobut-2-en-2-amine (PubChem CID 135244533) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is (Z)-4-[(3E,4E,6Z)-3-ethylidene-6-methyl-4-prop-1-en-2-ylocta-1,4,6-trien-2-yl]imino-3-fluorobut-2-en-2-amine.
| Compound Name | (Z)-4-[(3E,4E,6Z)-3-ethylidene-6-methyl-4-prop-1-en-2-ylocta-1,4,6-trien-2-yl]imino-3-fluorobut-2-en-2-amine |
|---|---|
| PubChem CID | 135244533 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (Z)-4-[(3E,4E,6Z)-3-ethylidene-6-methyl-4-prop-1-en-2-ylocta-1,4,6-trien-2-yl]imino-3-fluorobut-2-en-2-amine |
| SMILES | C=C(C)C(=C\C(C)=C/C)/C(=C\C)C(=C)/N=C/C(F)=C(\C)N |
| InChI | InChI=1S/C18H25FN2/c1-8-13(5)10-17(12(3)4)16(9-2)15(7)21-11-18(19)14(6)20/h8-11H,3,7,20H2,1-2,4-6H3/b13-8-,16-9-,17-10+,18-14-,21-11+ |
| InChIKey | SOYVNRAPTHLFEP-ITFVSAABSA-N |
| XLogP | 5.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|