C16H21F3N2 — CID 178040570
2-[[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine (PubChem CID 178040570) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine.
| Compound Name | 2-[[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine |
|---|---|
| PubChem CID | 178040570 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-[[(2Z,4E,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-4-yl]iminomethyl]cyclopenten-1-amine |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)\N=C\C1=C(N)CCC1 |
| InChI | InChI=1S/C16H21F3N2/c1-3-6-13(16(17,18)19)10-14(7-4-2)21-11-12-8-5-9-15(12)20/h4,6-7,10-11H,3,5,8-9,20H2,1-2H3/b7-4-,13-6-,14-10+,21-11+ |
| InChIKey | IGSONTMNVSAYBP-SZPSPKTRSA-N |
| XLogP | 4.81 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|