C16H20F2N2 — CID 166485412
(2E,6Z)-2-(3,3-difluorobut-1-en-2-yl)-4,5-dimethylidene-8-(methylideneamino)nona-2,6,8-trien-1-amine (PubChem CID 166485412) has the molecular formula C16H20F2N2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2E,6Z)-2-(3,3-difluorobut-1-en-2-yl)-4,5-dimethylidene-8-(methylideneamino)nona-2,6,8-trien-1-amine.
| Compound Name | (2E,6Z)-2-(3,3-difluorobut-1-en-2-yl)-4,5-dimethylidene-8-(methylideneamino)nona-2,6,8-trien-1-amine |
|---|---|
| PubChem CID | 166485412 |
| Molecular Formula | C16H20F2N2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2E,6Z)-2-(3,3-difluorobut-1-en-2-yl)-4,5-dimethylidene-8-(methylideneamino)nona-2,6,8-trien-1-amine |
| SMILES | C=NC(=C)/C=C\C(=C)C(=C)/C=C(/CN)C(=C)C(C)(F)F |
| InChI | InChI=1S/C16H20F2N2/c1-11(7-8-13(3)20-6)12(2)9-15(10-19)14(4)16(5,17)18/h7-9H,1-4,6,10,19H2,5H3/b8-7-,15-9- |
| InChIKey | LZYYDADKISOTFB-HNIGGUEPSA-N |
| XLogP | 3.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|