C19H29F3N2 — CID 142297284
ethane;(2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine (PubChem CID 142297284) has the molecular formula C19H29F3N2 and a molecular weight of 342.45 g/mol. Its IUPAC name is ethane;(2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine.
| Compound Name | ethane;(2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine |
|---|---|
| PubChem CID | 142297284 |
| Molecular Formula | C19H29F3N2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | ethane;(2Z,4E,6E,8Z)-6-methyl-5-(methylideneamino)-7-propan-2-yl-4-(trifluoromethyl)undeca-2,4,6,8,10-pentaen-1-amine |
| SMILES | C=C/C=C\C(=C(C)\C(N=C)=C(\C=C/CN)C(F)(F)F)C(C)C.CC |
| InChI | InChI=1S/C17H23F3N2.C2H6/c1-6-7-9-14(12(2)3)13(4)16(22-5)15(10-8-11-21)17(18,19)20;1-2/h6-10,12H,1,5,11,21H2,2-4H3;1-2H3/b9-7-,10-8-,14-13-,16-15+; |
| InChIKey | MALKJZLJHPNTPO-XJLKRGECSA-N |
| XLogP | 5.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|