C18H26N2 — CID 163248349
(2Z,4Z,6E,8E)-4-[(E)-but-2-enyl]-5-(methylideneamino)-6-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraen-1-amine (PubChem CID 163248349) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2Z,4Z,6E,8E)-4-[(E)-but-2-enyl]-5-(methylideneamino)-6-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraen-1-amine.
| Compound Name | (2Z,4Z,6E,8E)-4-[(E)-but-2-enyl]-5-(methylideneamino)-6-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 163248349 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2Z,4Z,6E,8E)-4-[(E)-but-2-enyl]-5-(methylideneamino)-6-[(Z)-prop-1-enyl]deca-2,4,6,8-tetraen-1-amine |
| SMILES | C=NC(=C(\C=C/CN)C/C=C/C)/C(/C=C\C)=C/C=C/C |
| InChI | InChI=1S/C18H26N2/c1-5-8-12-16(11-7-3)18(20-4)17(13-9-6-2)14-10-15-19/h5-12,14H,4,13,15,19H2,1-3H3/b8-5+,9-6+,11-7-,14-10-,16-12+,18-17- |
| InChIKey | PWLBTTOSUDRJFG-FNGBFZPDSA-N |
| XLogP | 4.50 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|