C10H13FN2 — CID 153350435
(2E)-3-fluoro-4,5-dimethylidene-2-(methylideneamino)hepta-2,6-dien-1-amine (PubChem CID 153350435) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is (2E)-3-fluoro-4,5-dimethylidene-2-(methylideneamino)hepta-2,6-dien-1-amine.
| Compound Name | (2E)-3-fluoro-4,5-dimethylidene-2-(methylideneamino)hepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 153350435 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (2E)-3-fluoro-4,5-dimethylidene-2-(methylideneamino)hepta-2,6-dien-1-amine |
| SMILES | C=CC(=C)C(=C)/C(F)=C(/CN)N=C |
| InChI | InChI=1S/C10H13FN2/c1-5-7(2)8(3)10(11)9(6-12)13-4/h5H,1-4,6,12H2/b10-9+ |
| InChIKey | IAOWKXYEMDMVQQ-MDZDMXLPSA-N |
| XLogP | 2.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|