C7H9F3N2 — CID 145224791
(2Z)-2-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-1-amine (PubChem CID 145224791) has the molecular formula C7H9F3N2 and a molecular weight of 178.16 g/mol. Its IUPAC name is (2Z)-2-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 145224791 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (2Z)-2-(methylideneamino)-4-(trifluoromethyl)penta-2,4-dien-1-amine |
| SMILES | C=N/C(=C\C(=C)C(F)(F)F)CN |
| InChI | InChI=1S/C7H9F3N2/c1-5(7(8,9)10)3-6(4-11)12-2/h3H,1-2,4,11H2/b6-3- |
| InChIKey | MYLYNVWZHUOWMB-UTCJRWHESA-N |
| XLogP | 1.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|