C7H12N2 — CID 142082739
(2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 142082739) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine.
| Compound Name | (2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142082739 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=N/C(=C\C(=C)C)CN |
| InChI | InChI=1S/C7H12N2/c1-6(2)4-7(5-8)9-3/h4H,1,3,5,8H2,2H3/b7-4- |
| InChIKey | SYOGUIPMQUELOX-DAXSKMNVSA-N |
| XLogP | 1.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|