C9H18N2 — CID 156819690
ethane;(2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 156819690) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;(2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine.
| Compound Name | ethane;(2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 156819690 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;(2Z)-4-methyl-2-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=N/C(=C\C(=C)C)CN.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-6(2)4-7(5-8)9-3;1-2/h4H,1,3,5,8H2,2H3;1-2H3/b7-4-; |
| InChIKey | NSZACRGONKDACM-ZULQGGHCSA-N |
| XLogP | 2.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|