C14H21N3 — CID 118213495
(3E,5Z,7Z,9Z)-3-(ethylideneamino)-4-methylundeca-1,3,5,7,9-pentaene-2,6-diamine (PubChem CID 118213495) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (3E,5Z,7Z,9Z)-3-(ethylideneamino)-4-methylundeca-1,3,5,7,9-pentaene-2,6-diamine.
| Compound Name | (3E,5Z,7Z,9Z)-3-(ethylideneamino)-4-methylundeca-1,3,5,7,9-pentaene-2,6-diamine |
|---|---|
| PubChem CID | 118213495 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (3E,5Z,7Z,9Z)-3-(ethylideneamino)-4-methylundeca-1,3,5,7,9-pentaene-2,6-diamine |
| SMILES | C=C(N)C(/N=C/C)=C(C)\C=C(N)\C=C/C=C\C |
| InChI | InChI=1S/C14H21N3/c1-5-7-8-9-13(16)10-11(3)14(12(4)15)17-6-2/h5-10H,4,15-16H2,1-3H3/b7-5-,9-8-,13-10-,14-11+,17-6+ |
| InChIKey | NPIXUMOUXQXHPD-MOSCUHDNSA-N |
| XLogP | 2.80 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|