C10H17FN2 — CID 137410374
(E)-4-fluoro-5-[(E)-2-methylbut-2-enyl]iminopent-2-en-2-amine (PubChem CID 137410374) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is (E)-4-fluoro-5-[(E)-2-methylbut-2-enyl]iminopent-2-en-2-amine.
| Compound Name | (E)-4-fluoro-5-[(E)-2-methylbut-2-enyl]iminopent-2-en-2-amine |
|---|---|
| PubChem CID | 137410374 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | (E)-4-fluoro-5-[(E)-2-methylbut-2-enyl]iminopent-2-en-2-amine |
| SMILES | C/C=C(\C)C/N=C/C(F)/C=C(\C)N |
| InChI | InChI=1S/C10H17FN2/c1-4-8(2)6-13-7-10(11)5-9(3)12/h4-5,7,10H,6,12H2,1-3H3/b8-4+,9-5+,13-7+ |
| InChIKey | ASINUGXRWPJFIL-DYHANEKBSA-N |
| XLogP | 2.22 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|