C12H19F3N2 — CID 155354012
(Z,2R)-3-[[(E)-1,1,1-trifluorohex-2-en-2-yl]iminomethyl]pent-3-en-2-amine (PubChem CID 155354012) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is (Z,2R)-3-[[(E)-1,1,1-trifluorohex-2-en-2-yl]iminomethyl]pent-3-en-2-amine.
| Compound Name | (Z,2R)-3-[[(E)-1,1,1-trifluorohex-2-en-2-yl]iminomethyl]pent-3-en-2-amine |
|---|---|
| PubChem CID | 155354012 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (Z,2R)-3-[[(E)-1,1,1-trifluorohex-2-en-2-yl]iminomethyl]pent-3-en-2-amine |
| SMILES | C/C=C(\C=N\C(=C\CCC)C(F)(F)F)[C@@H](C)N |
| InChI | InChI=1S/C12H19F3N2/c1-4-6-7-11(12(13,14)15)17-8-10(5-2)9(3)16/h5,7-9H,4,6,16H2,1-3H3/b10-5+,11-7+,17-8+/t9-/m1/s1 |
| InChIKey | GGZHKKBLLIXUBD-FUGJDYMGSA-N |
| XLogP | 3.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|