C12H19N — CID 90909232
N-[(4E)-2,6-dimethylocta-2,4,6-trien-3-yl]ethanimine (PubChem CID 90909232) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-[(4E)-2,6-dimethylocta-2,4,6-trien-3-yl]ethanimine.
| Compound Name | N-[(4E)-2,6-dimethylocta-2,4,6-trien-3-yl]ethanimine |
|---|---|
| PubChem CID | 90909232 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-[(4E)-2,6-dimethylocta-2,4,6-trien-3-yl]ethanimine |
| SMILES | CC=C(C)/C=C/C(/N=C/C)=C(C)C |
| InChI | InChI=1S/C12H19N/c1-6-11(5)8-9-12(10(3)4)13-7-2/h6-9H,1-5H3/b9-8+,11-6?,13-7+ |
| InChIKey | XRECITPUPLBNKZ-MLUVRDSISA-N |
| XLogP | 3.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|