C10H13N — CID 70417807
N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine (PubChem CID 70417807) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine.
| Compound Name | N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine |
|---|---|
| PubChem CID | 70417807 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine |
| SMILES | CC=C1C=CC=CC1/N=C/C |
| InChI | InChI=1S/C10H13N/c1-3-9-7-5-6-8-10(9)11-4-2/h3-8,10H,1-2H3/b9-3?,11-4+ |
| InChIKey | DNTDJTPPOSKEAG-ZTBAJKOFSA-N |
| XLogP | 2.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|