About Diethylideneaniline
Diethylideneaniline (PubChem CID 70417807) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | Diethylideneaniline |
| PubChem CID | 70417807 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine |
| SMILES | CC=C1C=CC=CC1N=CC |
| InChI | InChI=1S/C10H13N/c1-3-9-7-5-6-8-10(9)11-4-2/h3-8,10H,1-2H3 |
| InChIKey | DNTDJTPPOSKEAG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 231 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze Diethylideneaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethylideneaniline?
The IUPAC name of Diethylideneaniline (CID 70417807) is N-(6-ethylidenecyclohexa-2,4-dien-1-yl)ethanimine.
What is the SMILES notation for Diethylideneaniline?
The canonical SMILES for Diethylideneaniline is CC=C1C=CC=CC1N=CC.
What is the InChIKey of Diethylideneaniline?
The InChIKey is DNTDJTPPOSKEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-3-9-7-5-6-8-10(9)11-4-2/h3-8,10H,1-2H3.
What are the key properties of Diethylideneaniline?
Diethylideneaniline has a molecular weight of 147.22 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Diethylideneaniline is sourced from PubChem (CID 70417807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).