About 7aH-indole
7aH-indole (PubChem CID 20614426) has the molecular formula C8H7N
and a molecular weight of 117.15 g/mol. Its IUPAC name is 7aH-indole.
Molecular Properties
| Compound Name | 7aH-indole |
| PubChem CID | 20614426 |
| Molecular Formula | C8H7N |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | 7aH-indole |
| SMILES | C1=CC2=CC=NC2C=C1 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,8H |
| InChIKey | KKOMCKBPSXAJBJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7aH-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7aH-indole?
The IUPAC name of 7aH-indole (CID 20614426) is 7aH-indole.
What is the SMILES notation for 7aH-indole?
The canonical SMILES for 7aH-indole is C1=CC2=CC=NC2C=C1.
What is the InChIKey of 7aH-indole?
The InChIKey is KKOMCKBPSXAJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,8H.
What are the key properties of 7aH-indole?
7aH-indole has a molecular weight of 117.15 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7aH-indole is sourced from PubChem (CID 20614426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).