C14H19F2N — CID 130414005
(2Z,5E)-7,7-difluoro-6-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-2,5-dien-1-imine (PubChem CID 130414005) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is (2Z,5E)-7,7-difluoro-6-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-2,5-dien-1-imine.
| Compound Name | (2Z,5E)-7,7-difluoro-6-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 130414005 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2Z,5E)-7,7-difluoro-6-methyl-N-[(3Z)-penta-1,3-dien-2-yl]octa-2,5-dien-1-imine |
| SMILES | C=C(/C=C\C)/N=C\C=C/C/C=C(\C)C(C)(F)F |
| InChI | InChI=1S/C14H19F2N/c1-5-9-13(3)17-11-8-6-7-10-12(2)14(4,15)16/h5-6,8-11H,3,7H2,1-2,4H3/b8-6-,9-5-,12-10+,17-11+ |
| InChIKey | ORZHNXCKLRIJOQ-UJFXILLJSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|