C14H17F3N2 — CID 123431326
(E)-N-[3-(ethenyliminomethyl)buta-1,3-dien-2-yl]-6,6,6-trifluoro-5-methylhex-4-en-3-imine (PubChem CID 123431326) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is (E)-N-[3-(ethenyliminomethyl)buta-1,3-dien-2-yl]-6,6,6-trifluoro-5-methylhex-4-en-3-imine.
| Compound Name | (E)-N-[3-(ethenyliminomethyl)buta-1,3-dien-2-yl]-6,6,6-trifluoro-5-methylhex-4-en-3-imine |
|---|---|
| PubChem CID | 123431326 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (E)-N-[3-(ethenyliminomethyl)buta-1,3-dien-2-yl]-6,6,6-trifluoro-5-methylhex-4-en-3-imine |
| SMILES | C=C/N=C/C(=C)C(=C)/N=C(\C=C(/C)C(F)(F)F)CC |
| InChI | InChI=1S/C14H17F3N2/c1-6-13(8-11(4)14(15,16)17)19-12(5)10(3)9-18-7-2/h7-9H,2-3,5-6H2,1,4H3/b11-8+,18-9+,19-13+ |
| InChIKey | WCRMTSAUZMWDMV-BMQIRTEXSA-N |
| XLogP | 4.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|