C12H13F3N2 — CID 143483868
(E)-1-(4H-azepin-6-yl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine (PubChem CID 143483868) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is (E)-1-(4H-azepin-6-yl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine.
| Compound Name | (E)-1-(4H-azepin-6-yl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 143483868 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (E)-1-(4H-azepin-6-yl)-4,4,4-trifluoro-N,3-dimethylbut-2-en-1-imine |
| SMILES | C/N=C(\C=C(/C)C(F)(F)F)C1=CCC=CN=C1 |
| InChI | InChI=1S/C12H13F3N2/c1-9(12(13,14)15)7-11(16-2)10-5-3-4-6-17-8-10/h4-8H,3H2,1-2H3/b9-7+,16-11+ |
| InChIKey | VUNUJDPZXBNXKO-YIYNZMMQSA-N |
| XLogP | 3.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|