C11H9F3N2 — CID 154378465
2-(2,2,2-trifluoroethyl)-2H-1,4-benzodiazepine (PubChem CID 154378465) has the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-2H-1,4-benzodiazepine.
| Compound Name | 2-(2,2,2-trifluoroethyl)-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 154378465 |
| Molecular Formula | C11H9F3N2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-2H-1,4-benzodiazepine |
| SMILES | FC(F)(F)CC1C=NC=c2ccccc2=N1 |
| InChI | InChI=1S/C11H9F3N2/c12-11(13,14)5-9-7-15-6-8-3-1-2-4-10(8)16-9/h1-4,6-7,9H,5H2 |
| InChIKey | OHOSCUQCEFMDLO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |