C11H9F3N2 — CID 144677748
9-methyl-3-(trifluoromethyl)-6H-pyrido[2,3-c]azepine (PubChem CID 144677748) has the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. Its IUPAC name is 9-methyl-3-(trifluoromethyl)-6H-pyrido[2,3-c]azepine.
| Compound Name | 9-methyl-3-(trifluoromethyl)-6H-pyrido[2,3-c]azepine |
|---|---|
| PubChem CID | 144677748 |
| Molecular Formula | C11H9F3N2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 9-methyl-3-(trifluoromethyl)-6H-pyrido[2,3-c]azepine |
| SMILES | CC1=c2ncc(C(F)(F)F)cc2=CCC=N1 |
| InChI | InChI=1S/C11H9F3N2/c1-7-10-8(3-2-4-15-7)5-9(6-16-10)11(12,13)14/h3-6H,2H2,1H3 |
| InChIKey | OWWQQMZARXVKGA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |