C11H16F3N — CID 143347099
ethane;5-ethyl-2-(trifluoromethyl)-3H-azepine (PubChem CID 143347099) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is ethane;5-ethyl-2-(trifluoromethyl)-3H-azepine.
| Compound Name | ethane;5-ethyl-2-(trifluoromethyl)-3H-azepine |
|---|---|
| PubChem CID | 143347099 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | ethane;5-ethyl-2-(trifluoromethyl)-3H-azepine |
| SMILES | CC.CCC1=CCC(C(F)(F)F)=NC=C1 |
| InChI | InChI=1S/C9H10F3N.C2H6/c1-2-7-3-4-8(9(10,11)12)13-6-5-7;1-2/h3,5-6H,2,4H2,1H3;1-2H3 |
| InChIKey | LASPHQIQHOCNJO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |