C12H16F3N — CID 143684725
(3E,5E)-7,7,7-trifluoro-3,6-dimethyl-N-prop-2-enylhepta-3,5-dien-2-imine (PubChem CID 143684725) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is (3E,5E)-7,7,7-trifluoro-3,6-dimethyl-N-prop-2-enylhepta-3,5-dien-2-imine.
| Compound Name | (3E,5E)-7,7,7-trifluoro-3,6-dimethyl-N-prop-2-enylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 143684725 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (3E,5E)-7,7,7-trifluoro-3,6-dimethyl-N-prop-2-enylhepta-3,5-dien-2-imine |
| SMILES | C=CC/N=C(C)/C(C)=C/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N/c1-5-8-16-11(4)9(2)6-7-10(3)12(13,14)15/h5-7H,1,8H2,2-4H3/b9-6+,10-7+,16-11+ |
| InChIKey | UWDONQNRGGYIBP-JSMAFXSWSA-N |
| XLogP | 4.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|