C12H18F3N — CID 123788699
(4E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hepta-1,4-dien-3-imine (PubChem CID 123788699) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (4E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hepta-1,4-dien-3-imine.
| Compound Name | (4E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123788699 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4E)-5,6,6-trimethyl-N-(2,2,2-trifluoroethyl)hepta-1,4-dien-3-imine |
| SMILES | C=CC(/C=C(\C)C(C)(C)C)=N\CC(F)(F)F |
| InChI | InChI=1S/C12H18F3N/c1-6-10(16-8-12(13,14)15)7-9(2)11(3,4)5/h6-7H,1,8H2,2-5H3/b9-7+,16-10+ |
| InChIKey | NBDAJQWRHWAZCE-QCPPYIPPSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|